C30H27F3O4S — CID 91027654
[4-[5-(4-methoxyphenyl)-3-[4-(trifluoromethyl)phenyl]pent-2-en-4-ynyl]sulfanyl-2-methylphenyl] butaneperoxoate (PubChem CID 91027654) has the molecular formula C30H27F3O4S and a molecular weight of 540.60 g/mol. Its IUPAC name is [4-[5-(4-methoxyphenyl)-3-[4-(trifluoromethyl)phenyl]pent-2-en-4-ynyl]sulfanyl-2-methylphenyl] butaneperoxoate.
| Compound Name | [4-[5-(4-methoxyphenyl)-3-[4-(trifluoromethyl)phenyl]pent-2-en-4-ynyl]sulfanyl-2-methylphenyl] butaneperoxoate |
|---|---|
| PubChem CID | 91027654 |
| Molecular Formula | C30H27F3O4S |
| Molecular Weight | 540.60 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | [4-[5-(4-methoxyphenyl)-3-[4-(trifluoromethyl)phenyl]pent-2-en-4-ynyl]sulfanyl-2-methylphenyl] butaneperoxoate |
| SMILES | CCCC(=O)OOc1ccc(SCC=C(C#Cc2ccc(OC)cc2)c2ccc(C(F)(F)F)cc2)cc1C |
| InChI | InChI=1S/C30H27F3O4S/c1-4-5-29(34)37-36-28-17-16-27(20-21(28)2)38-19-18-24(9-6-22-7-14-26(35-3)15-8-22)23-10-12-25(13-11-23)30(31,32)33/h7-8,10-18,20H,4-5,19H2,1-3H3 |
| InChIKey | HUAYJVKFCIUVPK-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.60 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|