C28H23F3O3S — CID 91448487
[4-[5-(4-methoxyphenyl)-3-[4-(trifluoromethyl)phenyl]pent-2-en-4-ynyl]sulfanyl-2-methylphenyl] acetate (PubChem CID 91448487) has the molecular formula C28H23F3O3S and a molecular weight of 496.55 g/mol. Its IUPAC name is [4-[5-(4-methoxyphenyl)-3-[4-(trifluoromethyl)phenyl]pent-2-en-4-ynyl]sulfanyl-2-methylphenyl] acetate.
| Compound Name | [4-[5-(4-methoxyphenyl)-3-[4-(trifluoromethyl)phenyl]pent-2-en-4-ynyl]sulfanyl-2-methylphenyl] acetate |
|---|---|
| PubChem CID | 91448487 |
| Molecular Formula | C28H23F3O3S |
| Molecular Weight | 496.55 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | [4-[5-(4-methoxyphenyl)-3-[4-(trifluoromethyl)phenyl]pent-2-en-4-ynyl]sulfanyl-2-methylphenyl] acetate |
| SMILES | COc1ccc(C#CC(=CCSc2ccc(OC(C)=O)c(C)c2)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C28H23F3O3S/c1-19-18-26(14-15-27(19)34-20(2)32)35-17-16-23(7-4-21-5-12-25(33-3)13-6-21)22-8-10-24(11-9-22)28(29,30)31/h5-6,8-16,18H,17H2,1-3H3 |
| InChIKey | PQHJBDNZBJJJKB-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.55 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|