About carbon dioxide;1-methoxy-2-methyl-4-[2-[[4-(trifluoromethyl)phenoxy]methyl]butylsulfanyl]benzene
carbon dioxide;1-methoxy-2-methyl-4-[2-[[4-(trifluoromethyl)phenoxy]methyl]butylsulfanyl]benzene (PubChem CID 159280522) has the molecular formula C21H23F3O4S
and a molecular weight of 428.47 g/mol. Its IUPAC name is carbon dioxide;1-methoxy-2-methyl-4-[2-[[4-(trifluoromethyl)phenoxy]methyl]butylsulfanyl]benzene.
Molecular Properties
| Compound Name | carbon dioxide;1-methoxy-2-methyl-4-[2-[[4-(trifluoromethyl)phenoxy]methyl]butylsulfanyl]benzene |
| PubChem CID | 159280522 |
| Molecular Formula | C21H23F3O4S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | carbon dioxide;1-methoxy-2-methyl-4-[2-[[4-(trifluoromethyl)phenoxy]methyl]butylsulfanyl]benzene |
| SMILES | CCC(COc1ccc(C(F)(F)F)cc1)CSc1ccc(OC)c(C)c1.O=C=O |
| InChI | InChI=1S/C20H23F3O2S.CO2/c1-4-15(13-26-18-9-10-19(24-3)14(2)11-18)12-25-17-7-5-16(6-8-17)20(21,22)23;2-1-3/h5-11,15H,4,12-13H2,1-3H3; |
| InChIKey | KYVWVRNQGRCQJJ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze carbon dioxide;1-methoxy-2-methyl-4-[2-[[4-(trifluoromethyl)phenoxy]methyl]butylsulfanyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon dioxide;1-methoxy-2-methyl-4-[2-[[4-(trifluoromethyl)phenoxy]methyl]butylsulfanyl]benzene?
The IUPAC name of carbon dioxide;1-methoxy-2-methyl-4-[2-[[4-(trifluoromethyl)phenoxy]methyl]butylsulfanyl]benzene (CID 159280522) is carbon dioxide;1-methoxy-2-methyl-4-[2-[[4-(trifluoromethyl)phenoxy]methyl]butylsulfanyl]benzene.
What is the SMILES notation for carbon dioxide;1-methoxy-2-methyl-4-[2-[[4-(trifluoromethyl)phenoxy]methyl]butylsulfanyl]benzene?
The canonical SMILES for carbon dioxide;1-methoxy-2-methyl-4-[2-[[4-(trifluoromethyl)phenoxy]methyl]butylsulfanyl]benzene is CCC(COc1ccc(C(F)(F)F)cc1)CSc1ccc(OC)c(C)c1.O=C=O.
What is the InChIKey of carbon dioxide;1-methoxy-2-methyl-4-[2-[[4-(trifluoromethyl)phenoxy]methyl]butylsulfanyl]benzene?
The InChIKey is KYVWVRNQGRCQJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23F3O2S.CO2/c1-4-15(13-26-18-9-10-19(24-3)14(2)11-18)12-25-17-7-5-16(6-8-17)20(21,22)23;2-1-3/h5-11,15H,4,12-13H2,1-3H3;.
What are the key properties of carbon dioxide;1-methoxy-2-methyl-4-[2-[[4-(trifluoromethyl)phenoxy]methyl]butylsulfanyl]benzene?
carbon dioxide;1-methoxy-2-methyl-4-[2-[[4-(trifluoromethyl)phenoxy]methyl]butylsulfanyl]benzene has a molecular weight of 428.47 g/mol, XLogP of 5.64, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;1-methoxy-2-methyl-4-[2-[[4-(trifluoromethyl)phenoxy]methyl]butylsulfanyl]benzene is sourced from PubChem (CID 159280522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).