C20H20ClF3O3S — CID 11453276
2-[3-chloro-4-[2-[[4-(trifluoromethyl)phenoxy]methyl]butylsulfanyl]phenyl]acetic acid (PubChem CID 11453276) has the molecular formula C20H20ClF3O3S and a molecular weight of 432.89 g/mol. Its IUPAC name is 2-[3-chloro-4-[2-[[4-(trifluoromethyl)phenoxy]methyl]butylsulfanyl]phenyl]acetic acid.
| Compound Name | 2-[3-chloro-4-[2-[[4-(trifluoromethyl)phenoxy]methyl]butylsulfanyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 11453276 |
| Molecular Formula | C20H20ClF3O3S |
| Molecular Weight | 432.89 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | 2-[3-chloro-4-[2-[[4-(trifluoromethyl)phenoxy]methyl]butylsulfanyl]phenyl]acetic acid |
| SMILES | CCC(COc1ccc(C(F)(F)F)cc1)CSc1ccc(CC(=O)O)cc1Cl |
| InChI | InChI=1S/C20H20ClF3O3S/c1-2-13(11-27-16-6-4-15(5-7-16)20(22,23)24)12-28-18-8-3-14(9-17(18)21)10-19(25)26/h3-9,13H,2,10-12H2,1H3,(H,25,26) |
| InChIKey | POIUYYCLCDTXNS-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.89 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |