C19H20ClF3O3S — CID 121479683
5-chloro-4-[2-ethoxy-3-[4-(trifluoromethyl)phenoxy]propyl]sulfanyl-2-methylphenol (PubChem CID 121479683) has the molecular formula C19H20ClF3O3S and a molecular weight of 420.88 g/mol. Its IUPAC name is 5-chloro-4-[2-ethoxy-3-[4-(trifluoromethyl)phenoxy]propyl]sulfanyl-2-methylphenol.
| Compound Name | 5-chloro-4-[2-ethoxy-3-[4-(trifluoromethyl)phenoxy]propyl]sulfanyl-2-methylphenol |
|---|---|
| PubChem CID | 121479683 |
| Molecular Formula | C19H20ClF3O3S |
| Molecular Weight | 420.88 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | 5-chloro-4-[2-ethoxy-3-[4-(trifluoromethyl)phenoxy]propyl]sulfanyl-2-methylphenol |
| SMILES | CCOC(COc1ccc(C(F)(F)F)cc1)CSc1cc(C)c(O)cc1Cl |
| InChI | InChI=1S/C19H20ClF3O3S/c1-3-25-15(11-27-18-8-12(2)17(24)9-16(18)20)10-26-14-6-4-13(5-7-14)19(21,22)23/h4-9,15,24H,3,10-11H2,1-2H3 |
| InChIKey | ITEFZUSXDQFPBK-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.88 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |