C20H15ClF3NOS — CID 174468712
5-chloro-2-methyl-4-[[4-[5-(trifluoromethyl)-2-pyridinyl]phenyl]methylsulfanyl]phenol (PubChem CID 174468712) has the molecular formula C20H15ClF3NOS and a molecular weight of 409.86 g/mol. Its IUPAC name is 5-chloro-2-methyl-4-[[4-[5-(trifluoromethyl)-2-pyridinyl]phenyl]methylsulfanyl]phenol.
| Compound Name | 5-chloro-2-methyl-4-[[4-[5-(trifluoromethyl)-2-pyridinyl]phenyl]methylsulfanyl]phenol |
|---|---|
| PubChem CID | 174468712 |
| Molecular Formula | C20H15ClF3NOS |
| Molecular Weight | 409.86 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | 5-chloro-2-methyl-4-[[4-[5-(trifluoromethyl)-2-pyridinyl]phenyl]methylsulfanyl]phenol |
| SMILES | Cc1cc(SCc2ccc(-c3ccc(C(F)(F)F)cn3)cc2)c(Cl)cc1O |
| InChI | InChI=1S/C20H15ClF3NOS/c1-12-8-19(16(21)9-18(12)26)27-11-13-2-4-14(5-3-13)17-7-6-15(10-25-17)20(22,23)24/h2-10,26H,11H2,1H3 |
| InChIKey | IIHCRURFBZHMNL-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.86 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |