C15H14Cl2OS — CID 91029474
4-[(3,4-dichlorophenyl)methylsulfanyl]-2,5-dimethylphenol (PubChem CID 91029474) has the molecular formula C15H14Cl2OS and a molecular weight of 313.25 g/mol. Its IUPAC name is 4-[(3,4-dichlorophenyl)methylsulfanyl]-2,5-dimethylphenol.
| Compound Name | 4-[(3,4-dichlorophenyl)methylsulfanyl]-2,5-dimethylphenol |
|---|---|
| PubChem CID | 91029474 |
| Molecular Formula | C15H14Cl2OS |
| Molecular Weight | 313.25 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | 4-[(3,4-dichlorophenyl)methylsulfanyl]-2,5-dimethylphenol |
| SMILES | Cc1cc(SCc2ccc(Cl)c(Cl)c2)c(C)cc1O |
| InChI | InChI=1S/C15H14Cl2OS/c1-9-6-15(10(2)5-14(9)18)19-8-11-3-4-12(16)13(17)7-11/h3-7,18H,8H2,1-2H3 |
| InChIKey | ZUILUMNVBVHOOQ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.25 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |