C15H16ClNS — CID 43350016
2-chloro-5-[(2,4-dimethylphenyl)sulfanylmethyl]aniline (PubChem CID 43350016) has the molecular formula C15H16ClNS and a molecular weight of 277.82 g/mol. Its IUPAC name is 2-chloro-5-[(2,4-dimethylphenyl)sulfanylmethyl]aniline.
| Compound Name | 2-chloro-5-[(2,4-dimethylphenyl)sulfanylmethyl]aniline |
|---|---|
| PubChem CID | 43350016 |
| Molecular Formula | C15H16ClNS |
| Molecular Weight | 277.82 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 2-chloro-5-[(2,4-dimethylphenyl)sulfanylmethyl]aniline |
| SMILES | Cc1ccc(SCc2ccc(Cl)c(N)c2)c(C)c1 |
| InChI | InChI=1S/C15H16ClNS/c1-10-3-6-15(11(2)7-10)18-9-12-4-5-13(16)14(17)8-12/h3-8H,9,17H2,1-2H3 |
| InChIKey | BJWOUQJMPVUHIX-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.82 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|