About [4-[(2,4-dimethylphenyl)sulfanylmethyl]phenyl]-trimethylsilane
[4-[(2,4-dimethylphenyl)sulfanylmethyl]phenyl]-trimethylsilane (PubChem CID 103438735) has the molecular formula C18H24SSi
and a molecular weight of 300.54 g/mol. Its IUPAC name is [4-[(2,4-dimethylphenyl)sulfanylmethyl]phenyl]-trimethylsilane.
Molecular Properties
| Compound Name | [4-[(2,4-dimethylphenyl)sulfanylmethyl]phenyl]-trimethylsilane |
| PubChem CID | 103438735 |
| Molecular Formula | C18H24SSi |
| Molecular Weight | 300.54 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | [4-[(2,4-dimethylphenyl)sulfanylmethyl]phenyl]-trimethylsilane |
| SMILES | Cc1ccc(SCc2ccc([Si](C)(C)C)cc2)c(C)c1 |
| InChI | InChI=1S/C18H24SSi/c1-14-6-11-18(15(2)12-14)19-13-16-7-9-17(10-8-16)20(3,4)5/h6-12H,13H2,1-5H3 |
| InChIKey | FLUIWSGDZOAJGB-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 300.54 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [4-[(2,4-dimethylphenyl)sulfanylmethyl]phenyl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(2,4-dimethylphenyl)sulfanylmethyl]phenyl]-trimethylsilane?
The IUPAC name of [4-[(2,4-dimethylphenyl)sulfanylmethyl]phenyl]-trimethylsilane (CID 103438735) is [4-[(2,4-dimethylphenyl)sulfanylmethyl]phenyl]-trimethylsilane.
What is the SMILES notation for [4-[(2,4-dimethylphenyl)sulfanylmethyl]phenyl]-trimethylsilane?
The canonical SMILES for [4-[(2,4-dimethylphenyl)sulfanylmethyl]phenyl]-trimethylsilane is Cc1ccc(SCc2ccc([Si](C)(C)C)cc2)c(C)c1.
What is the InChIKey of [4-[(2,4-dimethylphenyl)sulfanylmethyl]phenyl]-trimethylsilane?
The InChIKey is FLUIWSGDZOAJGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24SSi/c1-14-6-11-18(15(2)12-14)19-13-16-7-9-17(10-8-16)20(3,4)5/h6-12H,13H2,1-5H3.
What are the key properties of [4-[(2,4-dimethylphenyl)sulfanylmethyl]phenyl]-trimethylsilane?
[4-[(2,4-dimethylphenyl)sulfanylmethyl]phenyl]-trimethylsilane has a molecular weight of 300.54 g/mol, XLogP of 5.14, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(2,4-dimethylphenyl)sulfanylmethyl]phenyl]-trimethylsilane is sourced from PubChem (CID 103438735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).