C11H15NS — CID 142030262
acetylene;(2,4-dimethylphenyl)sulfanylmethanamine (PubChem CID 142030262) has the molecular formula C11H15NS and a molecular weight of 193.31 g/mol. Its IUPAC name is acetylene;(2,4-dimethylphenyl)sulfanylmethanamine.
| Compound Name | acetylene;(2,4-dimethylphenyl)sulfanylmethanamine |
|---|---|
| PubChem CID | 142030262 |
| Molecular Formula | C11H15NS |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | acetylene;(2,4-dimethylphenyl)sulfanylmethanamine |
| SMILES | C#C.Cc1ccc(SCN)c(C)c1 |
| InChI | InChI=1S/C9H13NS.C2H2/c1-7-3-4-9(11-6-10)8(2)5-7;1-2/h3-5H,6,10H2,1-2H3;1-2H |
| InChIKey | KPSIGNYOLZAIDQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|