C12H19NOS — CID 64900528
3-amino-4-(2,4-dimethylphenyl)sulfanylbutan-1-ol (PubChem CID 64900528) has the molecular formula C12H19NOS and a molecular weight of 225.36 g/mol. Its IUPAC name is 3-amino-4-(2,4-dimethylphenyl)sulfanylbutan-1-ol.
| Compound Name | 3-amino-4-(2,4-dimethylphenyl)sulfanylbutan-1-ol |
|---|---|
| PubChem CID | 64900528 |
| Molecular Formula | C12H19NOS |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 3-amino-4-(2,4-dimethylphenyl)sulfanylbutan-1-ol |
| SMILES | Cc1ccc(SCC(N)CCO)c(C)c1 |
| InChI | InChI=1S/C12H19NOS/c1-9-3-4-12(10(2)7-9)15-8-11(13)5-6-14/h3-4,7,11,14H,5-6,8,13H2,1-2H3 |
| InChIKey | ZDVQFPNWBFNBGC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |