C8H10OS — CID 117033827
1-hydroxysulfanyl-2,4-dimethylbenzene (PubChem CID 117033827) has the molecular formula C8H10OS and a molecular weight of 154.23 g/mol. Its IUPAC name is 1-hydroxysulfanyl-2,4-dimethylbenzene.
| Compound Name | 1-hydroxysulfanyl-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 117033827 |
| Molecular Formula | C8H10OS |
| Molecular Weight | 154.23 g/mol |
| Exact Mass | 154.05 |
| IUPAC Name | 1-hydroxysulfanyl-2,4-dimethylbenzene |
| SMILES | Cc1ccc(SO)c(C)c1 |
| InChI | InChI=1S/C8H10OS/c1-6-3-4-8(10-9)7(2)5-6/h3-5,9H,1-2H3 |
| InChIKey | BDSAYNKPXONFBM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.23 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|