C11H15NOS — CID 23250907
S-(2,4-dimethylphenyl) N,N-dimethylcarbamothioate (PubChem CID 23250907) has the molecular formula C11H15NOS and a molecular weight of 209.31 g/mol. Its IUPAC name is S-(2,4-dimethylphenyl) N,N-dimethylcarbamothioate.
| Compound Name | S-(2,4-dimethylphenyl) N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 23250907 |
| Molecular Formula | C11H15NOS |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | S-(2,4-dimethylphenyl) N,N-dimethylcarbamothioate |
| SMILES | Cc1ccc(SC(=O)N(C)C)c(C)c1 |
| InChI | InChI=1S/C11H15NOS/c1-8-5-6-10(9(2)7-8)14-11(13)12(3)4/h5-7H,1-4H3 |
| InChIKey | MXAZATKFBMLUHB-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|