C9H9BrClNOS — CID 59492296
S-(5-bromo-2-chlorophenyl) N,N-dimethylcarbamothioate (PubChem CID 59492296) has the molecular formula C9H9BrClNOS and a molecular weight of 294.60 g/mol. Its IUPAC name is S-(5-bromo-2-chlorophenyl) N,N-dimethylcarbamothioate.
| Compound Name | S-(5-bromo-2-chlorophenyl) N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 59492296 |
| Molecular Formula | C9H9BrClNOS |
| Molecular Weight | 294.60 g/mol |
| Exact Mass | 292.93 |
| IUPAC Name | S-(5-bromo-2-chlorophenyl) N,N-dimethylcarbamothioate |
| SMILES | CN(C)C(=O)Sc1cc(Br)ccc1Cl |
| InChI | InChI=1S/C9H9BrClNOS/c1-12(2)9(13)14-8-5-6(10)3-4-7(8)11/h3-5H,1-2H3 |
| InChIKey | AEDZFRWWFYYFRH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.60 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|