C11H15BrN2OS — CID 43306070
2-(2-amino-4-bromophenyl)sulfanyl-N,N-dimethylpropanamide (PubChem CID 43306070) has the molecular formula C11H15BrN2OS and a molecular weight of 303.23 g/mol. Its IUPAC name is 2-(2-amino-4-bromophenyl)sulfanyl-N,N-dimethylpropanamide.
| Compound Name | 2-(2-amino-4-bromophenyl)sulfanyl-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 43306070 |
| Molecular Formula | C11H15BrN2OS |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | 2-(2-amino-4-bromophenyl)sulfanyl-N,N-dimethylpropanamide |
| SMILES | CC(Sc1ccc(Br)cc1N)C(=O)N(C)C |
| InChI | InChI=1S/C11H15BrN2OS/c1-7(11(15)14(2)3)16-10-5-4-8(12)6-9(10)13/h4-7H,13H2,1-3H3 |
| InChIKey | TXVMMQGSVOMSQM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|