C13H19BrN2OS — CID 79533528
2-(2-amino-5-bromophenyl)sulfanyl-N,N-diethylpropanamide (PubChem CID 79533528) has the molecular formula C13H19BrN2OS and a molecular weight of 331.28 g/mol. Its IUPAC name is 2-(2-amino-5-bromophenyl)sulfanyl-N,N-diethylpropanamide.
| Compound Name | 2-(2-amino-5-bromophenyl)sulfanyl-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 79533528 |
| Molecular Formula | C13H19BrN2OS |
| Molecular Weight | 331.28 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 2-(2-amino-5-bromophenyl)sulfanyl-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)C(C)Sc1cc(Br)ccc1N |
| InChI | InChI=1S/C13H19BrN2OS/c1-4-16(5-2)13(17)9(3)18-12-8-10(14)6-7-11(12)15/h6-9H,4-5,15H2,1-3H3 |
| InChIKey | TVJLHWXJWITUPV-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.28 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|