C14H19BrN2O2S — CID 83145220
2-(4-bromo-2-carbamothioylphenoxy)-N,N-diethylpropanamide (PubChem CID 83145220) has the molecular formula C14H19BrN2O2S and a molecular weight of 359.29 g/mol. Its IUPAC name is 2-(4-bromo-2-carbamothioylphenoxy)-N,N-diethylpropanamide.
| Compound Name | 2-(4-bromo-2-carbamothioylphenoxy)-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 83145220 |
| Molecular Formula | C14H19BrN2O2S |
| Molecular Weight | 359.29 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 2-(4-bromo-2-carbamothioylphenoxy)-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)C(C)Oc1ccc(Br)cc1C(N)=S |
| InChI | InChI=1S/C14H19BrN2O2S/c1-4-17(5-2)14(18)9(3)19-12-7-6-10(15)8-11(12)13(16)20/h6-9H,4-5H2,1-3H3,(H2,16,20) |
| InChIKey | GBHUPRPCJLTRMM-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.29 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|