C15H21BrN2O2S — CID 83136097
2-(4-bromo-2-carbamothioylphenoxy)-N-pentan-3-ylpropanamide (PubChem CID 83136097) has the molecular formula C15H21BrN2O2S and a molecular weight of 373.32 g/mol. Its IUPAC name is 2-(4-bromo-2-carbamothioylphenoxy)-N-pentan-3-ylpropanamide.
| Compound Name | 2-(4-bromo-2-carbamothioylphenoxy)-N-pentan-3-ylpropanamide |
|---|---|
| PubChem CID | 83136097 |
| Molecular Formula | C15H21BrN2O2S |
| Molecular Weight | 373.32 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | 2-(4-bromo-2-carbamothioylphenoxy)-N-pentan-3-ylpropanamide |
| SMILES | CCC(CC)NC(=O)C(C)Oc1ccc(Br)cc1C(N)=S |
| InChI | InChI=1S/C15H21BrN2O2S/c1-4-11(5-2)18-15(19)9(3)20-13-7-6-10(16)8-12(13)14(17)21/h6-9,11H,4-5H2,1-3H3,(H2,17,21)(H,18,19) |
| InChIKey | SXOWQBYQDSHSQA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.32 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|