C13H17Br2NO2 — CID 1234554
(2S)-N-[(2S)-butan-2-yl]-2-(2,4-dibromophenoxy)propanamide (PubChem CID 1234554) has the molecular formula C13H17Br2NO2 and a molecular weight of 379.09 g/mol. Its IUPAC name is (2S)-N-[(2S)-butan-2-yl]-2-(2,4-dibromophenoxy)propanamide.
| Compound Name | (2S)-N-[(2S)-butan-2-yl]-2-(2,4-dibromophenoxy)propanamide |
|---|---|
| PubChem CID | 1234554 |
| Molecular Formula | C13H17Br2NO2 |
| Molecular Weight | 379.09 g/mol |
| Exact Mass | 376.96 |
| IUPAC Name | (2S)-N-[(2S)-butan-2-yl]-2-(2,4-dibromophenoxy)propanamide |
| SMILES | CC[C@H](C)NC(=O)[C@H](C)Oc1ccc(Br)cc1Br |
| InChI | InChI=1S/C13H17Br2NO2/c1-4-8(2)16-13(17)9(3)18-12-6-5-10(14)7-11(12)15/h5-9H,4H2,1-3H3,(H,16,17)/t8-,9-/m0/s1 |
| InChIKey | ACBKARFLBWLKTB-IUCAKERBSA-N |
| XLogP | 3.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.09 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |