C19H21Br2NO2 — CID 40736855
(2R)-N-[2-[(2S)-butan-2-yl]phenyl]-2-(2,4-dibromophenoxy)propanamide (PubChem CID 40736855) has the molecular formula C19H21Br2NO2 and a molecular weight of 455.19 g/mol. Its IUPAC name is (2R)-N-[2-[(2S)-butan-2-yl]phenyl]-2-(2,4-dibromophenoxy)propanamide.
| Compound Name | (2R)-N-[2-[(2S)-butan-2-yl]phenyl]-2-(2,4-dibromophenoxy)propanamide |
|---|---|
| PubChem CID | 40736855 |
| Molecular Formula | C19H21Br2NO2 |
| Molecular Weight | 455.19 g/mol |
| Exact Mass | 452.99 |
| IUPAC Name | (2R)-N-[2-[(2S)-butan-2-yl]phenyl]-2-(2,4-dibromophenoxy)propanamide |
| SMILES | CC[C@H](C)c1ccccc1NC(=O)[C@@H](C)Oc1ccc(Br)cc1Br |
| InChI | InChI=1S/C19H21Br2NO2/c1-4-12(2)15-7-5-6-8-17(15)22-19(23)13(3)24-18-10-9-14(20)11-16(18)21/h5-13H,4H2,1-3H3,(H,22,23)/t12-,13+/m0/s1 |
| InChIKey | NLBZKBWDNWJRSE-QWHCGFSZSA-N |
| XLogP | 6.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.19 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |