C21H24BrNO3 — CID 7825807
[(2R)-1-[2-[(2S)-butan-2-yl]anilino]-1-oxopropan-2-yl] 2-(4-bromophenyl)acetate (PubChem CID 7825807) has the molecular formula C21H24BrNO3 and a molecular weight of 418.33 g/mol. Its IUPAC name is [(2R)-1-[2-[(2S)-butan-2-yl]anilino]-1-oxopropan-2-yl] 2-(4-bromophenyl)acetate.
| Compound Name | [(2R)-1-[2-[(2S)-butan-2-yl]anilino]-1-oxopropan-2-yl] 2-(4-bromophenyl)acetate |
|---|---|
| PubChem CID | 7825807 |
| Molecular Formula | C21H24BrNO3 |
| Molecular Weight | 418.33 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | [(2R)-1-[2-[(2S)-butan-2-yl]anilino]-1-oxopropan-2-yl] 2-(4-bromophenyl)acetate |
| SMILES | CC[C@H](C)c1ccccc1NC(=O)[C@@H](C)OC(=O)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C21H24BrNO3/c1-4-14(2)18-7-5-6-8-19(18)23-21(25)15(3)26-20(24)13-16-9-11-17(22)12-10-16/h5-12,14-15H,4,13H2,1-3H3,(H,23,25)/t14-,15+/m0/s1 |
| InChIKey | ZIZXZDKUWWICLF-LSDHHAIUSA-N |
| XLogP | 5.08 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.33 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |