C20H26BrN2O+ — CID 9040266
(4-bromophenyl)methyl-[2-[2-[(2R)-butan-2-yl]anilino]-2-oxoethyl]-methylazanium (PubChem CID 9040266) has the molecular formula C20H26BrN2O+ and a molecular weight of 390.35 g/mol. Its IUPAC name is (4-bromophenyl)methyl-[2-[2-[(2R)-butan-2-yl]anilino]-2-oxoethyl]-methylazanium.
| Compound Name | (4-bromophenyl)methyl-[2-[2-[(2R)-butan-2-yl]anilino]-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 9040266 |
| Molecular Formula | C20H26BrN2O+ |
| Molecular Weight | 390.35 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | (4-bromophenyl)methyl-[2-[2-[(2R)-butan-2-yl]anilino]-2-oxoethyl]-methylazanium |
| SMILES | CC[C@@H](C)c1ccccc1NC(=O)C[NH+](C)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C20H25BrN2O/c1-4-15(2)18-7-5-6-8-19(18)22-20(24)14-23(3)13-16-9-11-17(21)12-10-16/h5-12,15H,4,13-14H2,1-3H3,(H,22,24)/p+1/t15-/m1/s1 |
| InChIKey | QNAFATVXYNYVBG-OAHLLOKOSA-O |
| XLogP | 3.62 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |