C16H25NO — CID 94840429
N-[2-[(2S)-butan-2-yl]phenyl]-3,3-dimethylbutanamide (PubChem CID 94840429) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is N-[2-[(2S)-butan-2-yl]phenyl]-3,3-dimethylbutanamide.
| Compound Name | N-[2-[(2S)-butan-2-yl]phenyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 94840429 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | N-[2-[(2S)-butan-2-yl]phenyl]-3,3-dimethylbutanamide |
| SMILES | CC[C@H](C)c1ccccc1NC(=O)CC(C)(C)C |
| InChI | InChI=1S/C16H25NO/c1-6-12(2)13-9-7-8-10-14(13)17-15(18)11-16(3,4)5/h7-10,12H,6,11H2,1-5H3,(H,17,18)/t12-/m0/s1 |
| InChIKey | WXIPMTPPYRZYPA-LBPRGKRZSA-N |
| XLogP | 4.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |