C13H20N2O — CID 2974418
3-(2-butan-2-ylphenyl)-1,1-dimethylurea (PubChem CID 2974418) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 3-(2-butan-2-ylphenyl)-1,1-dimethylurea.
| Compound Name | 3-(2-butan-2-ylphenyl)-1,1-dimethylurea |
|---|---|
| PubChem CID | 2974418 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 3-(2-butan-2-ylphenyl)-1,1-dimethylurea |
| SMILES | CCC(C)c1ccccc1NC(=O)N(C)C |
| InChI | InChI=1S/C13H20N2O/c1-5-10(2)11-8-6-7-9-12(11)14-13(16)15(3)4/h6-10H,5H2,1-4H3,(H,14,16) |
| InChIKey | PLWAIKIALLNNPE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |