C17H29N3O — CID 8019165
(2S)-N-[2-[(2R)-butan-2-yl]phenyl]-2-[2-(dimethylamino)ethylamino]propanamide (PubChem CID 8019165) has the molecular formula C17H29N3O and a molecular weight of 291.44 g/mol. Its IUPAC name is (2S)-N-[2-[(2R)-butan-2-yl]phenyl]-2-[2-(dimethylamino)ethylamino]propanamide.
| Compound Name | (2S)-N-[2-[(2R)-butan-2-yl]phenyl]-2-[2-(dimethylamino)ethylamino]propanamide |
|---|---|
| PubChem CID | 8019165 |
| Molecular Formula | C17H29N3O |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.23 |
| IUPAC Name | (2S)-N-[2-[(2R)-butan-2-yl]phenyl]-2-[2-(dimethylamino)ethylamino]propanamide |
| SMILES | CC[C@@H](C)c1ccccc1NC(=O)[C@H](C)NCCN(C)C |
| InChI | InChI=1S/C17H29N3O/c1-6-13(2)15-9-7-8-10-16(15)19-17(21)14(3)18-11-12-20(4)5/h7-10,13-14,18H,6,11-12H2,1-5H3,(H,19,21)/t13-,14+/m1/s1 |
| InChIKey | YRYHZTDMVWWJPM-KGLIPLIRSA-N |
| XLogP | 2.68 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |