C21H24ClNO3 — CID 7750336
[(2R)-1-[2-[(2R)-butan-2-yl]anilino]-1-oxopropan-2-yl] 2-(4-chlorophenyl)acetate (PubChem CID 7750336) has the molecular formula C21H24ClNO3 and a molecular weight of 373.88 g/mol. Its IUPAC name is [(2R)-1-[2-[(2R)-butan-2-yl]anilino]-1-oxopropan-2-yl] 2-(4-chlorophenyl)acetate.
| Compound Name | [(2R)-1-[2-[(2R)-butan-2-yl]anilino]-1-oxopropan-2-yl] 2-(4-chlorophenyl)acetate |
|---|---|
| PubChem CID | 7750336 |
| Molecular Formula | C21H24ClNO3 |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | [(2R)-1-[2-[(2R)-butan-2-yl]anilino]-1-oxopropan-2-yl] 2-(4-chlorophenyl)acetate |
| SMILES | CC[C@@H](C)c1ccccc1NC(=O)[C@@H](C)OC(=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H24ClNO3/c1-4-14(2)18-7-5-6-8-19(18)23-21(25)15(3)26-20(24)13-16-9-11-17(22)12-10-16/h5-12,14-15H,4,13H2,1-3H3,(H,23,25)/t14-,15-/m1/s1 |
| InChIKey | GLEUVLLMCJLURA-HUUCEWRRSA-N |
| XLogP | 4.97 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |