C22H27NO5 — CID 8905168
[(2R)-1-[2-[(2S)-butan-2-yl]anilino]-1-oxopropan-2-yl] 2-(4-methoxyphenoxy)acetate (PubChem CID 8905168) has the molecular formula C22H27NO5 and a molecular weight of 385.46 g/mol. Its IUPAC name is [(2R)-1-[2-[(2S)-butan-2-yl]anilino]-1-oxopropan-2-yl] 2-(4-methoxyphenoxy)acetate.
| Compound Name | [(2R)-1-[2-[(2S)-butan-2-yl]anilino]-1-oxopropan-2-yl] 2-(4-methoxyphenoxy)acetate |
|---|---|
| PubChem CID | 8905168 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | [(2R)-1-[2-[(2S)-butan-2-yl]anilino]-1-oxopropan-2-yl] 2-(4-methoxyphenoxy)acetate |
| SMILES | CC[C@H](C)c1ccccc1NC(=O)[C@@H](C)OC(=O)COc1ccc(OC)cc1 |
| InChI | InChI=1S/C22H27NO5/c1-5-15(2)19-8-6-7-9-20(19)23-22(25)16(3)28-21(24)14-27-18-12-10-17(26-4)11-13-18/h6-13,15-16H,5,14H2,1-4H3,(H,23,25)/t15-,16+/m0/s1 |
| InChIKey | PABZUHNGLPAUCP-JKSUJKDBSA-N |
| XLogP | 4.16 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |