C20H25NO2S — CID 8907596
(2S)-N-[2-[(2R)-butan-2-yl]phenyl]-2-(4-methoxyphenyl)sulfanylpropanamide (PubChem CID 8907596) has the molecular formula C20H25NO2S and a molecular weight of 343.49 g/mol. Its IUPAC name is (2S)-N-[2-[(2R)-butan-2-yl]phenyl]-2-(4-methoxyphenyl)sulfanylpropanamide.
| Compound Name | (2S)-N-[2-[(2R)-butan-2-yl]phenyl]-2-(4-methoxyphenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 8907596 |
| Molecular Formula | C20H25NO2S |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | (2S)-N-[2-[(2R)-butan-2-yl]phenyl]-2-(4-methoxyphenyl)sulfanylpropanamide |
| SMILES | CC[C@@H](C)c1ccccc1NC(=O)[C@H](C)Sc1ccc(OC)cc1 |
| InChI | InChI=1S/C20H25NO2S/c1-5-14(2)18-8-6-7-9-19(18)21-20(22)15(3)24-17-12-10-16(23-4)11-13-17/h6-15H,5H2,1-4H3,(H,21,22)/t14-,15+/m1/s1 |
| InChIKey | AFJHZAHSBLNPPN-CABCVRRESA-N |
| XLogP | 5.33 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |