C19H22FNOS — CID 7284399
(2R)-N-[2-[(2R)-butan-2-yl]phenyl]-2-(4-fluorophenyl)sulfanylpropanamide (PubChem CID 7284399) has the molecular formula C19H22FNOS and a molecular weight of 331.46 g/mol. Its IUPAC name is (2R)-N-[2-[(2R)-butan-2-yl]phenyl]-2-(4-fluorophenyl)sulfanylpropanamide.
| Compound Name | (2R)-N-[2-[(2R)-butan-2-yl]phenyl]-2-(4-fluorophenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 7284399 |
| Molecular Formula | C19H22FNOS |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | (2R)-N-[2-[(2R)-butan-2-yl]phenyl]-2-(4-fluorophenyl)sulfanylpropanamide |
| SMILES | CC[C@@H](C)c1ccccc1NC(=O)[C@@H](C)Sc1ccc(F)cc1 |
| InChI | InChI=1S/C19H22FNOS/c1-4-13(2)17-7-5-6-8-18(17)21-19(22)14(3)23-16-11-9-15(20)10-12-16/h5-14H,4H2,1-3H3,(H,21,22)/t13-,14-/m1/s1 |
| InChIKey | KVYSCSXCTPRLLF-ZIAGYGMSSA-N |
| XLogP | 5.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |