C22H21NO2S2 — CID 94011837
(2S)-2-(4-methoxyphenyl)sulfanyl-N-(2-phenylsulfanylphenyl)propanamide (PubChem CID 94011837) has the molecular formula C22H21NO2S2 and a molecular weight of 395.55 g/mol. Its IUPAC name is (2S)-2-(4-methoxyphenyl)sulfanyl-N-(2-phenylsulfanylphenyl)propanamide.
| Compound Name | (2S)-2-(4-methoxyphenyl)sulfanyl-N-(2-phenylsulfanylphenyl)propanamide |
|---|---|
| PubChem CID | 94011837 |
| Molecular Formula | C22H21NO2S2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | (2S)-2-(4-methoxyphenyl)sulfanyl-N-(2-phenylsulfanylphenyl)propanamide |
| SMILES | COc1ccc(S[C@@H](C)C(=O)Nc2ccccc2Sc2ccccc2)cc1 |
| InChI | InChI=1S/C22H21NO2S2/c1-16(26-19-14-12-17(25-2)13-15-19)22(24)23-20-10-6-7-11-21(20)27-18-8-4-3-5-9-18/h3-16H,1-2H3,(H,23,24)/t16-/m0/s1 |
| InChIKey | MPGUFBPYOANRRP-INIZCTEOSA-N |
| XLogP | 5.97 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |