C17H17F2NO4S2 — CID 55873514
N-[2-(difluoromethylsulfonyl)phenyl]-2-(4-methoxyphenyl)sulfanylpropanamide (PubChem CID 55873514) has the molecular formula C17H17F2NO4S2 and a molecular weight of 401.46 g/mol. Its IUPAC name is N-[2-(difluoromethylsulfonyl)phenyl]-2-(4-methoxyphenyl)sulfanylpropanamide.
| Compound Name | N-[2-(difluoromethylsulfonyl)phenyl]-2-(4-methoxyphenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 55873514 |
| Molecular Formula | C17H17F2NO4S2 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | N-[2-(difluoromethylsulfonyl)phenyl]-2-(4-methoxyphenyl)sulfanylpropanamide |
| SMILES | COc1ccc(SC(C)C(=O)Nc2ccccc2S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C17H17F2NO4S2/c1-11(25-13-9-7-12(24-2)8-10-13)16(21)20-14-5-3-4-6-15(14)26(22,23)17(18)19/h3-11,17H,1-2H3,(H,20,21) |
| InChIKey | VMEVOXCYQDFSLD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |