C17H17Br2NO2 — CID 1019999
(2R)-2-(2,4-dibromophenoxy)-N-(3,5-dimethylphenyl)propanamide (PubChem CID 1019999) has the molecular formula C17H17Br2NO2 and a molecular weight of 427.14 g/mol. Its IUPAC name is (2R)-2-(2,4-dibromophenoxy)-N-(3,5-dimethylphenyl)propanamide.
| Compound Name | (2R)-2-(2,4-dibromophenoxy)-N-(3,5-dimethylphenyl)propanamide |
|---|---|
| PubChem CID | 1019999 |
| Molecular Formula | C17H17Br2NO2 |
| Molecular Weight | 427.14 g/mol |
| Exact Mass | 424.96 |
| IUPAC Name | (2R)-2-(2,4-dibromophenoxy)-N-(3,5-dimethylphenyl)propanamide |
| SMILES | Cc1cc(C)cc(NC(=O)[C@@H](C)Oc2ccc(Br)cc2Br)c1 |
| InChI | InChI=1S/C17H17Br2NO2/c1-10-6-11(2)8-14(7-10)20-17(21)12(3)22-16-5-4-13(18)9-15(16)19/h4-9,12H,1-3H3,(H,20,21)/t12-/m1/s1 |
| InChIKey | PCWZPFHNDZKNPD-GFCCVEGCSA-N |
| XLogP | 5.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.14 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |