C11H14BrN3O2S — CID 79533451
2-(2-amino-5-bromophenyl)sulfanyl-N-(methylcarbamoyl)propanamide (PubChem CID 79533451) has the molecular formula C11H14BrN3O2S and a molecular weight of 332.22 g/mol. Its IUPAC name is 2-(2-amino-5-bromophenyl)sulfanyl-N-(methylcarbamoyl)propanamide.
| Compound Name | 2-(2-amino-5-bromophenyl)sulfanyl-N-(methylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 79533451 |
| Molecular Formula | C11H14BrN3O2S |
| Molecular Weight | 332.22 g/mol |
| Exact Mass | 331.00 |
| IUPAC Name | 2-(2-amino-5-bromophenyl)sulfanyl-N-(methylcarbamoyl)propanamide |
| SMILES | CNC(=O)NC(=O)C(C)Sc1cc(Br)ccc1N |
| InChI | InChI=1S/C11H14BrN3O2S/c1-6(10(16)15-11(17)14-2)18-9-5-7(12)3-4-8(9)13/h3-6H,13H2,1-2H3,(H2,14,15,16,17) |
| InChIKey | UULYPUJMAVQELQ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.22 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|