C17H21NO2S — CID 115945257
N,N-diethyl-2-(4-hydroxynaphthalen-1-yl)sulfanylpropanamide (PubChem CID 115945257) has the molecular formula C17H21NO2S and a molecular weight of 303.43 g/mol. Its IUPAC name is N,N-diethyl-2-(4-hydroxynaphthalen-1-yl)sulfanylpropanamide.
| Compound Name | N,N-diethyl-2-(4-hydroxynaphthalen-1-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 115945257 |
| Molecular Formula | C17H21NO2S |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | N,N-diethyl-2-(4-hydroxynaphthalen-1-yl)sulfanylpropanamide |
| SMILES | CCN(CC)C(=O)C(C)Sc1ccc(O)c2ccccc12 |
| InChI | InChI=1S/C17H21NO2S/c1-4-18(5-2)17(20)12(3)21-16-11-10-15(19)13-8-6-7-9-14(13)16/h6-12,19H,4-5H2,1-3H3 |
| InChIKey | PCWXZUKVRKNWOE-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |