C17H21NO — CID 15100949
N,N-diethyl-2-naphthalen-1-ylpropanamide (PubChem CID 15100949) has the molecular formula C17H21NO and a molecular weight of 255.36 g/mol. Its IUPAC name is N,N-diethyl-2-naphthalen-1-ylpropanamide.
| Compound Name | N,N-diethyl-2-naphthalen-1-ylpropanamide |
|---|---|
| PubChem CID | 15100949 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | N,N-diethyl-2-naphthalen-1-ylpropanamide |
| SMILES | CCN(CC)C(=O)C(C)c1cccc2ccccc12 |
| InChI | InChI=1S/C17H21NO/c1-4-18(5-2)17(19)13(3)15-12-8-10-14-9-6-7-11-16(14)15/h6-13H,4-5H2,1-3H3 |
| InChIKey | LNLSSTYCHKETJD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |