C15H23NOS — CID 78841431
N,N-diethyl-2-[(2-methylphenyl)methylsulfanyl]propanamide (PubChem CID 78841431) has the molecular formula C15H23NOS and a molecular weight of 265.42 g/mol. Its IUPAC name is N,N-diethyl-2-[(2-methylphenyl)methylsulfanyl]propanamide.
| Compound Name | N,N-diethyl-2-[(2-methylphenyl)methylsulfanyl]propanamide |
|---|---|
| PubChem CID | 78841431 |
| Molecular Formula | C15H23NOS |
| Molecular Weight | 265.42 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | N,N-diethyl-2-[(2-methylphenyl)methylsulfanyl]propanamide |
| SMILES | CCN(CC)C(=O)C(C)SCc1ccccc1C |
| InChI | InChI=1S/C15H23NOS/c1-5-16(6-2)15(17)13(4)18-11-14-10-8-7-9-12(14)3/h7-10,13H,5-6,11H2,1-4H3 |
| InChIKey | PXZHATJOFHQLLG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.42 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |