C11H16OS — CID 115659346
2-[(2-methylphenyl)methylsulfanyl]propan-1-ol (PubChem CID 115659346) has the molecular formula C11H16OS and a molecular weight of 196.32 g/mol. Its IUPAC name is 2-[(2-methylphenyl)methylsulfanyl]propan-1-ol.
| Compound Name | 2-[(2-methylphenyl)methylsulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 115659346 |
| Molecular Formula | C11H16OS |
| Molecular Weight | 196.32 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | 2-[(2-methylphenyl)methylsulfanyl]propan-1-ol |
| SMILES | Cc1ccccc1CSC(C)CO |
| InChI | InChI=1S/C11H16OS/c1-9-5-3-4-6-11(9)8-13-10(2)7-12/h3-6,10,12H,7-8H2,1-2H3 |
| InChIKey | XBKOLQGRRBDRCY-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |