C10H12Cl2OS — CID 115659330
2-[(2,6-dichlorophenyl)methylsulfanyl]propan-1-ol (PubChem CID 115659330) has the molecular formula C10H12Cl2OS and a molecular weight of 251.18 g/mol. Its IUPAC name is 2-[(2,6-dichlorophenyl)methylsulfanyl]propan-1-ol.
| Compound Name | 2-[(2,6-dichlorophenyl)methylsulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 115659330 |
| Molecular Formula | C10H12Cl2OS |
| Molecular Weight | 251.18 g/mol |
| Exact Mass | 250.00 |
| IUPAC Name | 2-[(2,6-dichlorophenyl)methylsulfanyl]propan-1-ol |
| SMILES | CC(CO)SCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C10H12Cl2OS/c1-7(5-13)14-6-8-9(11)3-2-4-10(8)12/h2-4,7,13H,5-6H2,1H3 |
| InChIKey | IWXIROIBYILYTP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.18 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |