C7H5Cl3S — CID 141002030
(2,6-dichlorophenyl)methyl thiohypochlorite (PubChem CID 141002030) has the molecular formula C7H5Cl3S and a molecular weight of 227.54 g/mol. Its IUPAC name is (2,6-dichlorophenyl)methyl thiohypochlorite.
| Compound Name | (2,6-dichlorophenyl)methyl thiohypochlorite |
|---|---|
| PubChem CID | 141002030 |
| Molecular Formula | C7H5Cl3S |
| Molecular Weight | 227.54 g/mol |
| Exact Mass | 225.92 |
| IUPAC Name | (2,6-dichlorophenyl)methyl thiohypochlorite |
| SMILES | ClSCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C7H5Cl3S/c8-6-2-1-3-7(9)5(6)4-11-10/h1-3H,4H2 |
| InChIKey | HULRVWFXCLHEFP-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.54 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |