C8H9Cl2N2S+ — CID 3733113
[amino-[(2,6-dichlorophenyl)methylsulfanyl]methylidene]azanium (PubChem CID 3733113) has the molecular formula C8H9Cl2N2S+ and a molecular weight of 236.15 g/mol. Its IUPAC name is [amino-[(2,6-dichlorophenyl)methylsulfanyl]methylidene]azanium.
| Compound Name | [amino-[(2,6-dichlorophenyl)methylsulfanyl]methylidene]azanium |
|---|---|
| PubChem CID | 3733113 |
| Molecular Formula | C8H9Cl2N2S+ |
| Molecular Weight | 236.15 g/mol |
| Exact Mass | 234.99 |
| IUPAC Name | [amino-[(2,6-dichlorophenyl)methylsulfanyl]methylidene]azanium |
| SMILES | NC(=[NH2+])SCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C8H8Cl2N2S/c9-6-2-1-3-7(10)5(6)4-13-8(11)12/h1-3H,4H2,(H3,11,12)/p+1 |
| InChIKey | PHDJNQQXOMCMRL-UHFFFAOYSA-O |
| XLogP | 1.30 |
| TPSA | 51.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.15 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|