C9H10ClFN4S — CID 59411815
(2-chloro-6-fluorophenyl)methyl N-(diaminomethylidene)carbamimidothioate (PubChem CID 59411815) has the molecular formula C9H10ClFN4S and a molecular weight of 260.72 g/mol. Its IUPAC name is (2-chloro-6-fluorophenyl)methyl N-(diaminomethylidene)carbamimidothioate.
| Compound Name | (2-chloro-6-fluorophenyl)methyl N-(diaminomethylidene)carbamimidothioate |
|---|---|
| PubChem CID | 59411815 |
| Molecular Formula | C9H10ClFN4S |
| Molecular Weight | 260.72 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | (2-chloro-6-fluorophenyl)methyl N-(diaminomethylidene)carbamimidothioate |
| SMILES | [H]/N=C(\N=C(N)N)SCc1c(F)cccc1Cl |
| InChI | InChI=1S/C9H10ClFN4S/c10-6-2-1-3-7(11)5(6)4-16-9(14)15-8(12)13/h1-3H,4H2,(H5,12,13,14,15) |
| InChIKey | PJFSDEMQAMLPCG-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.72 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|