C18H20ClFN2S — CID 8775994
(2-chloro-6-fluorophenyl)methyl N'-[4-[(2S)-butan-2-yl]phenyl]carbamimidothioate (PubChem CID 8775994) has the molecular formula C18H20ClFN2S and a molecular weight of 350.89 g/mol. Its IUPAC name is (2-chloro-6-fluorophenyl)methyl N'-[4-[(2S)-butan-2-yl]phenyl]carbamimidothioate.
| Compound Name | (2-chloro-6-fluorophenyl)methyl N'-[4-[(2S)-butan-2-yl]phenyl]carbamimidothioate |
|---|---|
| PubChem CID | 8775994 |
| Molecular Formula | C18H20ClFN2S |
| Molecular Weight | 350.89 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | (2-chloro-6-fluorophenyl)methyl N'-[4-[(2S)-butan-2-yl]phenyl]carbamimidothioate |
| SMILES | CC[C@H](C)c1ccc(/N=C(\N)SCc2c(F)cccc2Cl)cc1 |
| InChI | InChI=1S/C18H20ClFN2S/c1-3-12(2)13-7-9-14(10-8-13)22-18(21)23-11-15-16(19)5-4-6-17(15)20/h4-10,12H,3,11H2,1-2H3,(H2,21,22)/t12-/m0/s1 |
| InChIKey | ZTCJDMDZMILLDX-LBPRGKRZSA-N |
| XLogP | 5.87 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.89 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|