C21H28N2O2S — CID 8776065
(4,5-dimethoxy-2-methylphenyl)methyl N'-[4-[(2R)-butan-2-yl]phenyl]carbamimidothioate (PubChem CID 8776065) has the molecular formula C21H28N2O2S and a molecular weight of 372.53 g/mol. Its IUPAC name is (4,5-dimethoxy-2-methylphenyl)methyl N'-[4-[(2R)-butan-2-yl]phenyl]carbamimidothioate.
| Compound Name | (4,5-dimethoxy-2-methylphenyl)methyl N'-[4-[(2R)-butan-2-yl]phenyl]carbamimidothioate |
|---|---|
| PubChem CID | 8776065 |
| Molecular Formula | C21H28N2O2S |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | (4,5-dimethoxy-2-methylphenyl)methyl N'-[4-[(2R)-butan-2-yl]phenyl]carbamimidothioate |
| SMILES | CC[C@@H](C)c1ccc(/N=C(\N)SCc2cc(OC)c(OC)cc2C)cc1 |
| InChI | InChI=1S/C21H28N2O2S/c1-6-14(2)16-7-9-18(10-8-16)23-21(22)26-13-17-12-20(25-5)19(24-4)11-15(17)3/h7-12,14H,6,13H2,1-5H3,(H2,22,23)/t14-/m1/s1 |
| InChIKey | AJGDAZNQLFJZQF-CQSZACIVSA-N |
| XLogP | 5.41 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|