C19H24N2O2S — CID 8775720
(4,5-dimethoxy-2-methylphenyl)methyl N'-[(1S)-1-phenylethyl]carbamimidothioate (PubChem CID 8775720) has the molecular formula C19H24N2O2S and a molecular weight of 344.48 g/mol. Its IUPAC name is (4,5-dimethoxy-2-methylphenyl)methyl N'-[(1S)-1-phenylethyl]carbamimidothioate.
| Compound Name | (4,5-dimethoxy-2-methylphenyl)methyl N'-[(1S)-1-phenylethyl]carbamimidothioate |
|---|---|
| PubChem CID | 8775720 |
| Molecular Formula | C19H24N2O2S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (4,5-dimethoxy-2-methylphenyl)methyl N'-[(1S)-1-phenylethyl]carbamimidothioate |
| SMILES | COc1cc(C)c(CS/C(N)=N/[C@@H](C)c2ccccc2)cc1OC |
| InChI | InChI=1S/C19H24N2O2S/c1-13-10-17(22-3)18(23-4)11-16(13)12-24-19(20)21-14(2)15-8-6-5-7-9-15/h5-11,14H,12H2,1-4H3,(H2,20,21)/t14-/m0/s1 |
| InChIKey | ITASNUJHGOOFKX-AWEZNQCLSA-N |
| XLogP | 4.32 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|