C19H24N2O2 — CID 6341030
(2R)-N'-[2-(3,4-dimethoxyphenyl)ethyl]-2-phenylpropanimidamide (PubChem CID 6341030) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is (2R)-N'-[2-(3,4-dimethoxyphenyl)ethyl]-2-phenylpropanimidamide.
| Compound Name | (2R)-N'-[2-(3,4-dimethoxyphenyl)ethyl]-2-phenylpropanimidamide |
|---|---|
| PubChem CID | 6341030 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | (2R)-N'-[2-(3,4-dimethoxyphenyl)ethyl]-2-phenylpropanimidamide |
| SMILES | COc1ccc(CC/N=C(\N)[C@H](C)c2ccccc2)cc1OC |
| InChI | InChI=1S/C19H24N2O2/c1-14(16-7-5-4-6-8-16)19(20)21-12-11-15-9-10-17(22-2)18(13-15)23-3/h4-10,13-14H,11-12H2,1-3H3,(H2,20,21)/t14-/m1/s1 |
| InChIKey | HIOYAHWBPJRPHG-CQSZACIVSA-N |
| XLogP | 3.41 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|