C13H19NO2 — CID 10857049
N-[2-(3,4-dimethoxyphenyl)ethyl]propan-2-imine (PubChem CID 10857049) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]propan-2-imine.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]propan-2-imine |
|---|---|
| PubChem CID | 10857049 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]propan-2-imine |
| SMILES | COc1ccc(CCN=C(C)C)cc1OC |
| InChI | InChI=1S/C13H19NO2/c1-10(2)14-8-7-11-5-6-12(15-3)13(9-11)16-4/h5-6,9H,7-8H2,1-4H3 |
| InChIKey | GUNVLFWKTPRLOJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|