C18H21ClN2O2S — CID 9357770
(4-chlorophenyl)methyl N'-[2-(3,4-dimethoxyphenyl)ethyl]carbamimidothioate (PubChem CID 9357770) has the molecular formula C18H21ClN2O2S and a molecular weight of 364.90 g/mol. Its IUPAC name is (4-chlorophenyl)methyl N'-[2-(3,4-dimethoxyphenyl)ethyl]carbamimidothioate.
| Compound Name | (4-chlorophenyl)methyl N'-[2-(3,4-dimethoxyphenyl)ethyl]carbamimidothioate |
|---|---|
| PubChem CID | 9357770 |
| Molecular Formula | C18H21ClN2O2S |
| Molecular Weight | 364.90 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | (4-chlorophenyl)methyl N'-[2-(3,4-dimethoxyphenyl)ethyl]carbamimidothioate |
| SMILES | COc1ccc(CC/N=C(\N)SCc2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C18H21ClN2O2S/c1-22-16-8-5-13(11-17(16)23-2)9-10-21-18(20)24-12-14-3-6-15(19)7-4-14/h3-8,11H,9-10,12H2,1-2H3,(H2,20,21) |
| InChIKey | FOACWSCWZGZPGZ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.90 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|