C16H24N2O2 — CID 63173820
N'-[2-(3,4-dimethoxyphenyl)ethyl]cyclopentanecarboximidamide (PubChem CID 63173820) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is N'-[2-(3,4-dimethoxyphenyl)ethyl]cyclopentanecarboximidamide.
| Compound Name | N'-[2-(3,4-dimethoxyphenyl)ethyl]cyclopentanecarboximidamide |
|---|---|
| PubChem CID | 63173820 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | N'-[2-(3,4-dimethoxyphenyl)ethyl]cyclopentanecarboximidamide |
| SMILES | COc1ccc(CC/N=C(\N)C2CCCC2)cc1OC |
| InChI | InChI=1S/C16H24N2O2/c1-19-14-8-7-12(11-15(14)20-2)9-10-18-16(17)13-5-3-4-6-13/h7-8,11,13H,3-6,9-10H2,1-2H3,(H2,17,18) |
| InChIKey | ATVOYKDZUSSFGQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|