C12H20ClN5O2 — CID 11358539
1-(diaminomethylidene)-2-[2-(3,4-dimethoxyphenyl)ethyl]guanidine;hydrochloride (PubChem CID 11358539) has the molecular formula C12H20ClN5O2 and a molecular weight of 301.78 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[2-(3,4-dimethoxyphenyl)ethyl]guanidine;hydrochloride.
| Compound Name | 1-(diaminomethylidene)-2-[2-(3,4-dimethoxyphenyl)ethyl]guanidine;hydrochloride |
|---|---|
| PubChem CID | 11358539 |
| Molecular Formula | C12H20ClN5O2 |
| Molecular Weight | 301.78 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 1-(diaminomethylidene)-2-[2-(3,4-dimethoxyphenyl)ethyl]guanidine;hydrochloride |
| SMILES | COc1ccc(CC/N=C(\N)N=C(N)N)cc1OC.Cl |
| InChI | InChI=1S/C12H19N5O2.ClH/c1-18-9-4-3-8(7-10(9)19-2)5-6-16-12(15)17-11(13)14;/h3-4,7H,5-6H2,1-2H3,(H6,13,14,15,16,17);1H |
| InChIKey | QPZFVVMOWLSOEQ-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 121.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.78 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|