C18H22N2O2S — CID 8773671
benzyl N'-[2-(3,4-dimethoxyphenyl)ethyl]carbamimidothioate (PubChem CID 8773671) has the molecular formula C18H22N2O2S and a molecular weight of 330.45 g/mol. Its IUPAC name is benzyl N'-[2-(3,4-dimethoxyphenyl)ethyl]carbamimidothioate.
| Compound Name | benzyl N'-[2-(3,4-dimethoxyphenyl)ethyl]carbamimidothioate |
|---|---|
| PubChem CID | 8773671 |
| Molecular Formula | C18H22N2O2S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | benzyl N'-[2-(3,4-dimethoxyphenyl)ethyl]carbamimidothioate |
| SMILES | COc1ccc(CC/N=C(\N)SCc2ccccc2)cc1OC |
| InChI | InChI=1S/C18H22N2O2S/c1-21-16-9-8-14(12-17(16)22-2)10-11-20-18(19)23-13-15-6-4-3-5-7-15/h3-9,12H,10-11,13H2,1-2H3,(H2,19,20) |
| InChIKey | ILMJSKXEZLZCMW-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|